ChemNet > CAS > 782-17-2 2-(4-Fluorophenyl)indole
782-17-2 2-(4-Fluorophenyl)indole
produktnavn |
2-(4-Fluorophenyl)indole |
Synonymer |
2-(naphth-2-yl)-1h-indole; 2-(4-fluorophenyl)-1H-indole; 6-(4-fluorophenyl)-1H-indole |
Molekylær Formel |
C14H10FN |
Molekylvekt |
211.2343 |
InChI |
InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H |
CAS-nummer |
782-17-2 |
Molecular Structure |
|
Tetthet |
1.233g/cm3 |
Smeltepunkt |
190-192℃ |
Kokepunkt |
389.094°C at 760 mmHg |
Brytningsindeks |
1.658 |
Flammepunktet |
189.118°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|