ChemNet > CAS > 78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
78583-81-0 3-(4-chlorophenyl)-1H-pyrazol-5-amine
produktnavn |
3-(4-chlorophenyl)-1H-pyrazol-5-amine |
Synonymer |
5-(4-chlorophenyl)-1H-pyrazol-3-amine |
Molekylær Formel |
C9H8ClN3 |
Molekylvekt |
193.6329 |
InChI |
InChI=1/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
CAS-nummer |
78583-81-0 |
Molecular Structure |
|
Tetthet |
1.378g/cm3 |
Smeltepunkt |
172℃ |
Kokepunkt |
463.8°C at 760 mmHg |
Brytningsindeks |
1.67 |
Flammepunktet |
234.3°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|