ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
produktnavn |
5-Bromo-2-ethoxybenzaldehyde |
Molekylær Formel |
C9H9BrO2 |
Molekylvekt |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
CAS-nummer |
79636-94-5 |
Molecular Structure |
|
Tetthet |
1.451g/cm3 |
Smeltepunkt |
68℃ |
Kokepunkt |
302.7°C at 760 mmHg |
Brytningsindeks |
1.573 |
Flammepunktet |
136.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|