ChemNet > CAS > 82769-76-4 (S)-3-Amino-3-phenylpropan-1-ol
82769-76-4 (S)-3-Amino-3-phenylpropan-1-ol
| produktnavn |
(S)-3-Amino-3-phenylpropan-1-ol |
| Synonymer |
(S)-1-Phenyl-3-propanolamine; (S)-3-Amino-3-phenylpropi-1-ol; (S)-3-Amino-3-phenylpropan-l-ol; (3S)-3-amino-3-phenyl-propan-1-ol hydrochloride |
| Molekylær Formel |
C9H14ClNO |
| Molekylvekt |
187.6666 |
| InChI |
InChI=1/C9H13NO.ClH/c10-9(6-7-11)8-4-2-1-3-5-8;/h1-5,9,11H,6-7,10H2;1H/t9-;/m0./s1 |
| CAS-nummer |
82769-76-4 |
| Molecular Structure |
|
| Kokepunkt |
325.3°C at 760 mmHg |
| Flammepunktet |
150.5°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
