ChemNet > CAS > 83902-00-5 2-ethyl-1H-imidazole-5-carbaldehyde
83902-00-5 2-ethyl-1H-imidazole-5-carbaldehyde
| produktnavn |
2-ethyl-1H-imidazole-5-carbaldehyde |
| Synonymer |
2-Ethyl-4-Formylimidazole |
| Molekylær Formel |
C6H8N2O |
| Molekylvekt |
124.1405 |
| InChI |
InChI=1/C6H8N2O/c1-2-6-7-3-5(4-9)8-6/h3-4H,2H2,1H3,(H,7,8) |
| CAS-nummer |
83902-00-5 |
| Molecular Structure |
|
| Tetthet |
1.177g/cm3 |
| Kokepunkt |
355.3°C at 760 mmHg |
| Brytningsindeks |
1.579 |
| Flammepunktet |
172.6°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
