ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
produktnavn |
3-chloro-4-fluorophenylhydrazine |
Molekylær Formel |
C6H6ClFN2 |
Molekylvekt |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
CAS-nummer |
84282-78-0 |
Molecular Structure |
|
Tetthet |
1.43g/cm3 |
Smeltepunkt |
62-63℃ |
Kokepunkt |
253.1°C at 760 mmHg |
Brytningsindeks |
1.624 |
Flammepunktet |
106.9°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|