ChemNet > CAS > 86454-13-9 2-hydroxy-6-methylisonicotinic acid
86454-13-9 2-hydroxy-6-methylisonicotinic acid
| produktnavn |
2-hydroxy-6-methylisonicotinic acid |
| Synonymer |
6-methyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid; 2-Hydroxy-6-Methylpyridine-4-Carboxylic Acid |
| Molekylær Formel |
C7H7NO3 |
| Molekylvekt |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c1-4-2-5(7(10)11)3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
| CAS-nummer |
86454-13-9 |
| Molecular Structure |
|
| Tetthet |
1.345g/cm3 |
| Smeltepunkt |
330℃ |
| Kokepunkt |
371.2°C at 760 mmHg |
| Brytningsindeks |
1.555 |
| Flammepunktet |
178.3°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
