ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
produktnavn |
2-Chloro-6-fluoroacetophenone |
Synonymer |
1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
Molekylær Formel |
C8H6ClFO |
Molekylvekt |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
CAS-nummer |
87327-69-3 |
Molecular Structure |
|
Tetthet |
1.258g/cm3 |
Kokepunkt |
191.8°C at 760 mmHg |
Brytningsindeks |
1.512 |
Flammepunktet |
69.8°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|