ChemNet > CAS > 880-09-1 Dipiperidinomethane
880-09-1 Dipiperidinomethane
produktnavn |
Dipiperidinomethane |
Synonymer |
1,1-Methylenedipiperidine; 1,1'-methanediyldipiperidine; 1,1'-methanediyldipiperidinium |
Molekylær Formel |
C11H24N2 |
Molekylvekt |
184.3206 |
InChI |
InChI=1/C11H22N2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-11H2/p+2 |
CAS-nummer |
880-09-1 |
EINECS |
212-911-2 |
Molecular Structure |
|
Kokepunkt |
245.3°C at 760 mmHg |
Flammepunktet |
91.7°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|