ChemNet > CAS > 88127-85-9 5-chloro-4-(chloromethyl)-1,2,3-thiadiazole
88127-85-9 5-chloro-4-(chloromethyl)-1,2,3-thiadiazole
produktnavn |
5-chloro-4-(chloromethyl)-1,2,3-thiadiazole |
Molekylær Formel |
C3H2Cl2N2S |
Molekylvekt |
169.0324 |
InChI |
InChI=1/C3H2Cl2N2S/c4-1-2-3(5)8-7-6-2/h1H2 |
CAS-nummer |
88127-85-9 |
Molecular Structure |
|
Tetthet |
1.609g/cm3 |
Kokepunkt |
249.5°C at 760 mmHg |
Brytningsindeks |
1.59 |
Flammepunktet |
104.7°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|