ChemNet > CAS > 886-66-8 1,4-Diphenylbutadiyne
886-66-8 1,4-Diphenylbutadiyne
produktnavn |
1,4-Diphenylbutadiyne |
Molekylær Formel |
C16H10 |
Molekylvekt |
202.2506 |
InChI |
InChI=1/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H |
CAS-nummer |
886-66-8 |
EINECS |
212-953-1 |
Molecular Structure |
|
Tetthet |
1.1g/cm3 |
Smeltepunkt |
85-88℃ |
Kokepunkt |
338.2°C at 760 mmHg |
Brytningsindeks |
1.642 |
Flammepunktet |
150.5°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|