ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
| produktnavn |
2-Hydroxy-4,6-dimethoxyacetophenone |
| Synonymer |
xanthoxylin |
| Molekylær Formel |
C10H12O4 |
| Molekylvekt |
196.1999 |
| InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| CAS-nummer |
90-24-4 |
| EINECS |
201-978-3 |
| Molecular Structure |
|
| Tetthet |
1.172g/cm3 |
| Smeltepunkt |
80-82℃ |
| Kokepunkt |
355.1°C at 760 mmHg |
| Brytningsindeks |
1.527 |
| Flammepunktet |
141.2°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
