ChemNet > CAS > 90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
produktnavn |
1-Chloro-4-iodo-2,5-dimethoxy-benzene |
Synonymer |
1-Chloro-4-iodo-2,5-dimethoxybenzene |
Molekylær Formel |
C8H8ClIO2 |
Molekylvekt |
298.5054 |
InChI |
InChI=1/C8H8ClIO2/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4H,1-2H3 |
CAS-nummer |
90064-46-3 |
Molecular Structure |
|
Tetthet |
1.74g/cm3 |
Smeltepunkt |
115℃ |
Kokepunkt |
324.8°C at 760 mmHg |
Brytningsindeks |
1.584 |
Flammepunktet |
150.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|