ChemNet > CAS > 90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
produktnavn |
3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione |
Synonymer |
3-(hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
Molekylær Formel |
C4H6N2OS3 |
Molekylvekt |
194.2982 |
InChI |
InChI=1/C4H6N2OS3/c1-9-3-5-6(2-7)4(8)10-3/h7H,2H2,1H3 |
CAS-nummer |
90567-39-8 |
Molecular Structure |
|
Tetthet |
1.64g/cm3 |
Smeltepunkt |
72℃ |
Kokepunkt |
306.9°C at 760 mmHg |
Brytningsindeks |
1.771 |
Flammepunktet |
139.4°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|