ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
| produktnavn |
2,3-Benzanthracene |
| Synonymer |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
| Molekylær Formel |
C18H12 |
| Molekylvekt |
228.2879 |
| InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| CAS-nummer |
92-24-0 |
| EINECS |
202-138-9 |
| Molecular Structure |
|
| Tetthet |
1.19g/cm3 |
| Smeltepunkt |
300℃ |
| Kokepunkt |
436.7°C at 760 mmHg |
| Brytningsindeks |
1.771 |
| Flammepunktet |
209.1°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R40:Possible risks of irreversible effects.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
