ChemNet > CAS > 932-66-1 1-Acetyl-1-cyclohexene
932-66-1 1-Acetyl-1-cyclohexene
produktnavn |
1-Acetyl-1-cyclohexene |
Synonymer |
cyclohex-1-enyl methyl ketone; 1-(cyclohex-1-en-1-yl)ethanone |
Molekylær Formel |
C8H12O |
Molekylvekt |
124.1803 |
InChI |
InChI=1/C8H12O/c1-7(9)8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
CAS-nummer |
932-66-1 |
EINECS |
213-256-5 |
Molecular Structure |
|
Tetthet |
0.962g/cm3 |
Smeltepunkt |
73-202℃ |
Kokepunkt |
201.7°C at 760 mmHg |
Brytningsindeks |
1.477 |
Flammepunktet |
73.2°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|