ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
produktnavn |
2,3,5-Trichlorophenol |
Molekylær Formel |
C6H3Cl3O |
Molekylvekt |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
CAS-nummer |
933-78-8 |
EINECS |
213-272-2 |
Molecular Structure |
|
Tetthet |
1.596g/cm3 |
Smeltepunkt |
57-60℃ |
Kokepunkt |
250.2°C at 760 mmHg |
Brytningsindeks |
1.608 |
Flammepunktet |
105.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|