ChemNet > CAS > 935-44-4 1-Phenyl-1-cyclopropanecarbonitrile
935-44-4 1-Phenyl-1-cyclopropanecarbonitrile
produktnavn |
1-Phenyl-1-cyclopropanecarbonitrile |
Synonymer |
1-Phenylcyclopropanecarbonitrile |
Molekylær Formel |
C10H9N |
Molekylvekt |
143.1852 |
InChI |
InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
CAS-nummer |
935-44-4 |
EINECS |
213-304-5 |
Molecular Structure |
|
Tetthet |
1.09g/cm3 |
Kokepunkt |
238.5°C at 760 mmHg |
Brytningsindeks |
1.571 |
Flammepunktet |
99°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|