ChemNet > CAS > 93560-55-5 2-Iodo-3-methoxypyridine
93560-55-5 2-Iodo-3-methoxypyridine
produktnavn |
2-Iodo-3-methoxypyridine |
Molekylær Formel |
C6H6INO |
Molekylvekt |
235.0224 |
InChI |
InChI=1/C6H6INO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS-nummer |
93560-55-5 |
Molecular Structure |
|
Tetthet |
1.825g/cm3 |
Kokepunkt |
271.2°C at 760 mmHg |
Brytningsindeks |
1.598 |
Flammepunktet |
117.8°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|