ChemNet > CAS > 959-22-8 4-Nitrophenyl benzoate
959-22-8 4-Nitrophenyl benzoate
produktnavn |
4-Nitrophenyl benzoate |
Synonymer |
Benzoic acid 4-nitrophenyl ester |
Molekylær Formel |
C13H9NO4 |
Molekylvekt |
243.2149 |
InChI |
InChI=1/C13H9NO4/c15-13(10-4-2-1-3-5-10)18-12-8-6-11(7-9-12)14(16)17/h1-9H |
CAS-nummer |
959-22-8 |
Molecular Structure |
|
Tetthet |
1.316g/cm3 |
Kokepunkt |
399.5°C at 760 mmHg |
Brytningsindeks |
1.614 |
Flammepunktet |
183.5°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|