ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
| produktnavn |
3-Methyl-4-nitrobenzonitrile |
| Synonymer |
4-Nitro-m-tolunitrile;
|
| Molekylær Formel |
C8H6N2O2 |
| Molekylvekt |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
| CAS-nummer |
96784-54-2 |
| Molecular Structure |
|
| Tetthet |
1.26g/cm3 |
| Smeltepunkt |
82-83℃ |
| Kokepunkt |
322.2°C at 760 mmHg |
| Brytningsindeks |
1.568 |
| Flammepunktet |
148.6°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
