ChemNet > CAS > 10160-87-9 3,3-diethoxy-1-propyne
10160-87-9 3,3-diethoxy-1-propyne
| Nazwa produktu: |
3,3-diethoxy-1-propyne |
| Synonimy |
Propiolaldehyde diethyl acetal; Propargylaldehyde diethyl acetal; 3,3-diethoxyprop-1-yne; Propynal diethyl acetal |
| MF |
C7H12O2 |
| Masie cząsteczkowej |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| Nr CAS |
10160-87-9 |
| EINECS |
233-430-4 |
| Struktury molekularnej |
|
| Gęstość |
0.909g/cm3 |
| Temperatura wrzenia |
139°C at 760 mmHg |
| Współczynnik załamania |
1.421 |
| Temperatura zapłonu |
32.2°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
