ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
Nazwa produktu: |
Ethyl hydrogen glutarate |
Synonimy |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
MF |
C7H12O4 |
Masie cząsteczkowej |
160.1678 |
InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
Nr CAS |
1070-62-8 |
EINECS |
213-977-5 |
Struktury molekularnej |
|
Gęstość |
1.126g/cm3 |
Temperatura wrzenia |
280°C at 760 mmHg |
Współczynnik załamania |
1.444 |
Temperatura zapłonu |
112.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|