ChemNet > CAS > 107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
107535-73-9 2,3,5,6-Tetrafluorobenzoyl chloride
Nazwa produktu: |
2,3,5,6-Tetrafluorobenzoyl chloride |
MF |
C7HClF4O |
Masie cząsteczkowej |
212.5289 |
InChI |
InChI=1/C7HClF4O/c8-7(13)4-5(11)2(9)1-3(10)6(4)12/h1H |
Nr CAS |
107535-73-9 |
Struktury molekularnej |
|
Gęstość |
1.601g/cm3 |
Temperatura wrzenia |
172.1°C at 760 mmHg |
Współczynnik załamania |
1.461 |
Temperatura zapłonu |
57.9°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|