ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
Nazwa produktu: |
2,6-Dibromo-4-nitrotoluene |
Synonimy |
1,3-dibromo-2-methyl-5-nitrobenzene |
MF |
C7H5Br2NO2 |
Masie cząsteczkowej |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
Nr CAS |
110127-07-6 |
Struktury molekularnej |
|
Gęstość |
1.967g/cm3 |
Temperatura wrzenia |
320.4°C at 760 mmHg |
Współczynnik załamania |
1.625 |
Temperatura zapłonu |
147.6°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|