ChemNet > CAS > 1135-12-2 4-Aminodiphenylmethane
1135-12-2 4-Aminodiphenylmethane
Nazwa produktu: |
4-Aminodiphenylmethane |
Synonimy |
4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
MF |
C13H13N |
Masie cząsteczkowej |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
Nr CAS |
1135-12-2 |
Struktury molekularnej |
|
Gęstość |
1.07g/cm3 |
Temperatura wrzenia |
300°C at 760 mmHg |
Współczynnik załamania |
1.616 |
Temperatura zapłonu |
159.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|