ChemNet > CAS > 116668-47-4 6-Amino-2-naphthoic acid
116668-47-4 6-Amino-2-naphthoic acid
Nazwa produktu: |
6-Amino-2-naphthoic acid |
MF |
C11H8NO2 |
Masie cząsteczkowej |
186.1873 |
InChI |
InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1 |
Nr CAS |
116668-47-4 |
Struktury molekularnej |
|
Temperatura topnienia |
222-227℃ |
Temperatura wrzenia |
416.7°C at 760 mmHg |
Temperatura zapłonu |
205.8°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|