ChemNet > CAS > 122-28-1 3-Nitroacetanilide
122-28-1 3-Nitroacetanilide
| Nazwa produktu: |
3-Nitroacetanilide |
| Synonimy |
m-Nitroacetanilide; 3'-Nitroacetanilide; 3-Nitro-N-acetylaniline; AI3-08832; N-(3-Nitrophenyl)acetamide; N-Acetyl-m-nitroaniline; NSC 1314; Acetamide, N-(3-nitrophenyl)-; Acetanilide, 3'-nitro- (8CI) |
| MF |
C8H8N2O3 |
| Masie cząsteczkowej |
180.1607 |
| InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-3-2-4-8(5-7)10(12)13/h2-5H,1H3,(H,9,11) |
| Nr CAS |
122-28-1 |
| EINECS |
204-532-6 |
| Struktury molekularnej |
|
| Gęstość |
1.34g/cm3 |
| Temperatura wrzenia |
379°C at 760 mmHg |
| Współczynnik załamania |
1.617 |
| Temperatura zapłonu |
183°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
