ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
Nazwa produktu: |
2,5-Dibromo-3-methylthiophene |
MF |
C5H4Br2S |
Masie cząsteczkowej |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
Nr CAS |
13191-36-1 |
EINECS |
236-147-4 |
Struktury molekularnej |
|
Gęstość |
2.006g/cm3 |
Temperatura wrzenia |
230.2°C at 760 mmHg |
Współczynnik załamania |
1.62 |
Temperatura zapłonu |
93°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|