ChemNet > CAS > 132980-99-5 3,5-difluorobenzamide
132980-99-5 3,5-difluorobenzamide
Nazwa produktu: |
3,5-difluorobenzamide |
Synonimy |
Difluorobenzamide6 |
MF |
C7H5F2NO |
Masie cząsteczkowej |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
Nr CAS |
132980-99-5 |
Struktury molekularnej |
|
Gęstość |
1.348g/cm3 |
Temperatura topnienia |
155-157℃ |
Temperatura wrzenia |
187.7°C at 760 mmHg |
Współczynnik załamania |
1.515 |
Temperatura zapłonu |
67.3°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|