ChemNet > CAS > 13327-27-0 6-Methylpyridazin-3(2H)-one
13327-27-0 6-Methylpyridazin-3(2H)-one
Nazwa produktu: |
6-Methylpyridazin-3(2H)-one |
Synonimy |
6-Methyl-3(2H)-pyridazinone; 6-Methylpyridazin-3-one;
; 6-methylpyridazin-3-ol; 6-Methyl-2H-pyridazin-3-one |
MF |
C5H6N2O |
Masie cząsteczkowej |
110.1139 |
InChI |
InChI=1/C5H6N2O/c1-4-2-3-5(8)7-6-4/h2-3H,1H3,(H,7,8) |
Nr CAS |
13327-27-0 |
EINECS |
236-367-0 |
Struktury molekularnej |
|
Gęstość |
1.22g/cm3 |
Temperatura wrzenia |
310.3°C at 760 mmHg |
Współczynnik załamania |
1.576 |
Temperatura zapłonu |
141.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|