ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| Nazwa produktu: |
2-acetyl-3-methylthiophene |
| Synonimy |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| MF |
C7H8OS |
| Masie cząsteczkowej |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| Nr CAS |
13679-72-6 |
| EINECS |
237-179-1 |
| Struktury molekularnej |
|
| Gęstość |
1.106g/cm3 |
| Temperatura wrzenia |
214.9°C at 760 mmHg |
| Współczynnik załamania |
1.535 |
| Temperatura zapłonu |
92.3°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
