ChemNet > CAS > 13735-12-1 6-Chlorothiochroman-4-one
13735-12-1 6-Chlorothiochroman-4-one
Nazwa produktu: |
6-Chlorothiochroman-4-one |
Synonimy |
6-Chloro-3,4-dihydro-2H-1-benzothiin-4-one; 6-chloro-2,3-dihydro-4H-thiochromen-4-one |
MF |
C9H7ClOS |
Masie cząsteczkowej |
198.6693 |
InChI |
InChI=1/C9H7ClOS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
Nr CAS |
13735-12-1 |
Struktury molekularnej |
|
Gęstość |
1.377g/cm3 |
Temperatura topnienia |
64℃ |
Temperatura wrzenia |
342.7°C at 760 mmHg |
Współczynnik załamania |
1.634 |
Temperatura zapłonu |
161.1°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|