ChemNet > CAS > 140675-43-0 2-Fluoro-6-hydroxybenzonitrile
140675-43-0 2-Fluoro-6-hydroxybenzonitrile
Nazwa produktu: |
2-Fluoro-6-hydroxybenzonitrile |
Synonimy |
2-Cyano-3-fluorophenol; 2-fluoro-6-hydroxybenzonitrle |
MF |
C8H5FO |
Masie cząsteczkowej |
136.1231 |
InChI |
InChI=1/C8H5FO/c1-2-6-7(9)4-3-5-8(6)10/h1,3-5,10H |
Nr CAS |
140675-43-0 |
Struktury molekularnej |
|
Współczynnik załamania |
1.56 |
Symbole zagrożenia |
|
Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|