ChemNet > CAS > 153863-35-5 (5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol
153863-35-5 (5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol
Nazwa produktu: |
(5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol |
MF |
C11H12N2O |
Masie cząsteczkowej |
188.2258 |
InChI |
InChI=1/C11H12N2O/c1-9-10(8-14)7-12-13(9)11-5-3-2-4-6-11/h2-7,14H,8H2,1H3 |
Nr CAS |
153863-35-5 |
Struktury molekularnej |
|
Gęstość |
1.14g/cm3 |
Temperatura topnienia |
88℃ |
Temperatura wrzenia |
346°C at 760 mmHg |
Współczynnik załamania |
1.593 |
Temperatura zapłonu |
163.1°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|