ChemNet > CAS > 15499-27-1 4-n-Butylchlorobenzene
15499-27-1 4-n-Butylchlorobenzene
Nazwa produktu: |
4-n-Butylchlorobenzene |
Synonimy |
1-n-Butyl-4-chlorobenzene; 4-Chloro-n-butylbenzene; 1-butyl-4-chlorobenzene |
MF |
C10H13Cl |
Masie cząsteczkowej |
168.6632 |
InChI |
InChI=1/C10H13Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
Nr CAS |
15499-27-1 |
Struktury molekularnej |
|
Gęstość |
1.008g/cm3 |
Temperatura wrzenia |
216.6°C at 760 mmHg |
Współczynnik załamania |
1.509 |
Temperatura zapłonu |
88°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|