ChemNet > CAS > 157664-47-6 (2-bromo-3-thienyl)methylamine
157664-47-6 (2-bromo-3-thienyl)methylamine
| Nazwa produktu: |
(2-bromo-3-thienyl)methylamine |
| Synonimy |
1-(2-bromothiophen-3-yl)methanamine; 1-(2-bromothiophen-3-yl)methanamine hydrochloride; 2-bromo-3-thiophenemethylamine;
|
| MF |
C5H7BrClNS |
| Masie cząsteczkowej |
228.5378 |
| InChI |
InChI=1/C5H6BrNS.ClH/c6-5-4(3-7)1-2-8-5;/h1-2H,3,7H2;1H |
| Nr CAS |
157664-47-6 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
244.7°C at 760 mmHg |
| Temperatura zapłonu |
101.8°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
