ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
Nazwa produktu: |
3-Chloro-4-fluorobenzyl alcohol |
Synonimy |
(3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
MF |
C7H6ClFO |
Masie cząsteczkowej |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
Nr CAS |
161446-90-8 |
Struktury molekularnej |
|
Gęstość |
1.344g/cm3 |
Temperatura wrzenia |
242.5°C at 760 mmHg |
Współczynnik załamania |
1.542 |
Temperatura zapłonu |
100.4°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|