ChemNet > CAS > 16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
Nazwa produktu: |
2-(Dicyanomethylene)indane-1,3-dione |
Synonimy |
(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)malononitrile; 2-(Dicyanomethylene)indan-1,3-dione; 2-(Dicyanomethylene)indene-1,3-dione; Propanedinitrile, (1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; Propanedinitrile, 2-(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; (1,3-dioxo-1,3-dihydro-2H-inden-2-ylidene)propanedinitrile |
MF |
C12H4N2O2 |
Masie cząsteczkowej |
208.1724 |
InChI |
InChI=1/C12H4N2O2/c13-5-7(6-14)10-11(15)8-3-1-2-4-9(8)12(10)16/h1-4H |
Nr CAS |
16954-74-8 |
Struktury molekularnej |
|
Gęstość |
1.485g/cm3 |
Temperatura wrzenia |
347.9°C at 760 mmHg |
Współczynnik załamania |
1.664 |
Temperatura zapłonu |
164.2°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|