ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
| Nazwa produktu: |
4-Amino-3-ethylbenzonitrile |
| Synonimy |
4-Cyano-2-ethylaniline |
| MF |
C9H10N2 |
| Masie cząsteczkowej |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
| Nr CAS |
170230-87-2 |
| Struktury molekularnej |
|
| Gęstość |
1.07g/cm3 |
| Temperatura wrzenia |
297.1°C at 760 mmHg |
| Współczynnik załamania |
1.562 |
| Temperatura zapłonu |
133.5°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
