ChemNet > CAS > 1706-11-2 2,5-Dimethylanisole
1706-11-2 2,5-Dimethylanisole
Nazwa produktu: |
2,5-Dimethylanisole |
Synonimy |
1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
MF |
C9H12O |
Masie cząsteczkowej |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
Nr CAS |
1706-11-2 |
EINECS |
216-943-8 |
Struktury molekularnej |
|
Gęstość |
0.932g/cm3 |
Temperatura wrzenia |
189.7°C at 760 mmHg |
Współczynnik załamania |
1.495 |
Temperatura zapłonu |
66.1°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|