ChemNet > CAS > 175135-96-3 ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate
175135-96-3 ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate
Nazwa produktu: |
ethyl 3-(2-chloro-3,4-dimethoxyphenyl)acrylate |
Synonimy |
ethyl (2E)-3-(2-chloro-3,4-dimethoxyphenyl)prop-2-enoate |
MF |
C13H15ClO4 |
Masie cząsteczkowej |
270.7088 |
InChI |
InChI=1/C13H15ClO4/c1-4-18-11(15)8-6-9-5-7-10(16-2)13(17-3)12(9)14/h5-8H,4H2,1-3H3/b8-6+ |
Nr CAS |
175135-96-3 |
Struktury molekularnej |
|
Gęstość |
1.193g/cm3 |
Temperatura topnienia |
68℃ |
Temperatura wrzenia |
382.4°C at 760 mmHg |
Współczynnik załamania |
1.542 |
Temperatura zapłonu |
151.5°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|