ChemNet > CAS > 175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
175137-12-9 3-chloro-4-methylthiophene-2-carbohydrazide
Nazwa produktu: |
3-chloro-4-methylthiophene-2-carbohydrazide |
MF |
C6H7ClN2OS |
Masie cząsteczkowej |
190.6506 |
InChI |
InChI=1/C6H7ClN2OS/c1-3-2-11-5(4(3)7)6(10)9-8/h2H,8H2,1H3,(H,9,10) |
Nr CAS |
175137-12-9 |
Struktury molekularnej |
|
Gęstość |
1.415g/cm3 |
Temperatura topnienia |
130℃ |
Współczynnik załamania |
1.613 |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|