ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
| Nazwa produktu: |
6-methoxypyridine-3-carbothioamide |
| Synonimy |
6-methoxy-3-Pyridinecarbothioamide |
| MF |
C7H8N2OS |
| Masie cząsteczkowej |
168.2162 |
| InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
| Nr CAS |
175277-49-3 |
| Struktury molekularnej |
|
| Gęstość |
1.262g/cm3 |
| Temperatura topnienia |
150℃ |
| Temperatura wrzenia |
292.5°C at 760 mmHg |
| Współczynnik załamania |
1.626 |
| Temperatura zapłonu |
130.7°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
