ChemNet > CAS > 17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
17608-10-5 2-(4-Chlorophenyl)ethyl isothiocyanate
| Nazwa produktu: |
2-(4-Chlorophenyl)ethyl isothiocyanate |
| Synonimy |
2-(4-Chlorophenethyl) isothiocyanate; 1-chloro-4-(2-isothiocyanatoethyl)benzene |
| MF |
C9H8ClNS |
| Masie cząsteczkowej |
197.6845 |
| InChI |
InChI=1/C9H8ClNS/c10-9-3-1-8(2-4-9)5-6-11-7-12/h1-4H,5-6H2 |
| Nr CAS |
17608-10-5 |
| Struktury molekularnej |
|
| Gęstość |
1.15g/cm3 |
| Temperatura wrzenia |
311°C at 760 mmHg |
| Współczynnik załamania |
1.572 |
| Temperatura zapłonu |
141.9°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
