ChemNet > CAS > 1766-76-3 decafluorobenzhydrol
1766-76-3 decafluorobenzhydrol
| Nazwa produktu: |
decafluorobenzhydrol |
| Synonimy |
Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| MF |
C13H2F10O |
| Masie cząsteczkowej |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| Nr CAS |
1766-76-3 |
| EINECS |
217-185-0 |
| Struktury molekularnej |
|
| Gęstość |
1.74g/cm3 |
| Temperatura topnienia |
76-80℃ |
| Temperatura wrzenia |
265.2°C at 760 mmHg |
| Współczynnik załamania |
1.457 |
| Temperatura zapłonu |
114.2°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
