ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
Nazwa produktu: |
adamantane-1-carbohydrazide |
Synonimy |
tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
MF |
C11H18N2O |
Masie cząsteczkowej |
194.2734 |
InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
Nr CAS |
17846-15-0 |
Struktury molekularnej |
|
Gęstość |
1.203g/cm3 |
Temperatura topnienia |
157℃ |
Temperatura wrzenia |
370.8°C at 760 mmHg |
Współczynnik załamania |
1.581 |
Temperatura zapłonu |
178°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|