ChemNet > CAS > 18536-91-9 Dodecyltriethoxysilane
18536-91-9 Dodecyltriethoxysilane
Nazwa produktu: |
Dodecyltriethoxysilane |
Synonimy |
n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
MF |
C16H30O2 |
Masie cząsteczkowej |
254.4082 |
InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
Nr CAS |
18536-91-9 |
EINECS |
242-409-9 |
Struktury molekularnej |
|
Gęstość |
0.886g/cm3 |
Temperatura wrzenia |
353.1°C at 760 mmHg |
Współczynnik załamania |
1.444 |
Temperatura zapłonu |
132.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|