ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
Nazwa produktu: |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
Synonimy |
[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
MF |
C10H7BrO2 |
Masie cząsteczkowej |
239.0654 |
InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
Nr CAS |
187657-92-7 |
EINECS |
260-718-7 |
Struktury molekularnej |
|
Gęstość |
1.582g/cm3 |
Temperatura topnienia |
136℃ |
Temperatura wrzenia |
306.8°C at 760 mmHg |
Współczynnik załamania |
1.636 |
Temperatura zapłonu |
139.3°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|