ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
Nazwa produktu: |
2,4-Dichloro-beta-nitrostyrene |
Synonimy |
1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
MF |
C8H5Cl2NO2 |
Masie cząsteczkowej |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
Nr CAS |
18984-21-9 |
Struktury molekularnej |
|
Gęstość |
1.447g/cm3 |
Temperatura wrzenia |
334.1°C at 760 mmHg |
Współczynnik załamania |
1.626 |
Temperatura zapłonu |
155.9°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|